About 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one)
1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) (PubChem CID 159999531) has the molecular formula C66H127N5O5
and a molecular weight of 1070.77 g/mol. Its IUPAC name is 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one).
Molecular Properties
| Compound Name | 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) |
| PubChem CID | 159999531 |
| Molecular Formula | C66H127N5O5 |
| Molecular Weight | 1070.77 g/mol |
| Exact Mass | 1069.98 |
| IUPAC Name | 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) |
| SMILES | CCCCCCCCCN1CCC(=O)CC1.CCCCCCCCN1CCCC(=O)C1.CCCCCCCCN1CCCC(=O)C1.CCCCCCCCN1CCCCC1=O.CCCCCCCCN1CCCCC1=O |
| InChI | InChI=1S/C14H27NO.4C13H25NO/c1-2-3-4-5-6-7-8-11-15-12-9-14(16)10-13-15;2*1-2-3-4-5-6-8-11-14-12-9-7-10-13(14)15;2*1-2-3-4-5-6-7-10-14-11-8-9-13(15)12-14/h2-13H2,1H3;4*2-12H2,1H3 |
| InChIKey | OHZHXCWOEHOXHH-UHFFFAOYSA-N |
| XLogP | 16.14 |
| TPSA | 101.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 76 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1070.77 |
| LogP ≤ 5 | 16.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one)?
The IUPAC name of 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) (CID 159999531) is 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one).
What is the SMILES notation for 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one)?
The canonical SMILES for 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) is CCCCCCCCCN1CCC(=O)CC1.CCCCCCCCN1CCCC(=O)C1.CCCCCCCCN1CCCC(=O)C1.CCCCCCCCN1CCCCC1=O.CCCCCCCCN1CCCCC1=O.
What is the InChIKey of 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one)?
The InChIKey is OHZHXCWOEHOXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO.4C13H25NO/c1-2-3-4-5-6-7-8-11-15-12-9-14(16)10-13-15;2*1-2-3-4-5-6-8-11-14-12-9-7-10-13(14)15;2*1-2-3-4-5-6-7-10-14-11-8-9-13(15)12-14/h2-13H2,1H3;4*2-12H2,1H3.
What are the key properties of 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one)?
1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) has a molecular weight of 1070.77 g/mol, XLogP of 16.14, 36 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonylpiperidin-4-one;bis(1-octylpiperidin-2-one);bis(1-octylpiperidin-3-one) is sourced from PubChem (CID 159999531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).