About N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan
N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan (PubChem CID 16007169) has the molecular formula C27H34N4O5
and a molecular weight of 494.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-phenylbutanoic acid.
Molecular Properties
| Compound Name | N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan |
| PubChem CID | 16007169 |
| Molecular Formula | C27H34N4O5 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-phenylbutanoic acid |
| SMILES | C1=CC=C(C=C1)CC[C@@H](C(=O)O)N[C@@H](CCCCN)C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O |
| InChI | InChI=1S/C27H34N4O5/c28-15-7-6-12-22(30-23(26(33)34)14-13-18-8-2-1-3-9-18)25(32)31-24(27(35)36)16-19-17-29-21-11-5-4-10-20(19)21/h1-5,8-11,17,22-24,29-30H,6-7,12-16,28H2,(H,31,32)(H,33,34)(H,35,36)/t22-,23-,24-/m0/s1 |
| InChIKey | JXNGDSIPMBNTNL-HJOGWXRNSA-N |
| XLogP | -2.40 |
| TPSA | 158.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | 714 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan?
The IUPAC name of N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan (CID 16007169) is (2S)-2-[[(2S)-6-amino-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-1-oxohexan-2-yl]amino]-4-phenylbutanoic acid.
What is the SMILES notation for N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan?
The canonical SMILES for N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan is C1=CC=C(C=C1)CC[C@@H](C(=O)O)N[C@@H](CCCCN)C(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)O.
What is the InChIKey of N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan?
The InChIKey is JXNGDSIPMBNTNL-HJOGWXRNSA-N. The full InChI is InChI=1S/C27H34N4O5/c28-15-7-6-12-22(30-23(26(33)34)14-13-18-8-2-1-3-9-18)25(32)31-24(27(35)36)16-19-17-29-21-11-5-4-10-20(19)21/h1-5,8-11,17,22-24,29-30H,6-7,12-16,28H2,(H,31,32)(H,33,34)(H,35,36)/t22-,23-,24-/m0/s1.
What are the key properties of N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan?
N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan has a molecular weight of 494.60 g/mol, XLogP of -2.40, 15 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N~2~-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-L-tryptophan is sourced from PubChem (CID 16007169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).