C25H20ClFN2O2 — CID 16010018
2-(3-Chlorobenzoyl)-1-(4-fluorophenyl)-6-methoxy-1H,2H,3H,4H,9H-pyrido[3,4-B]indole (PubChem CID 16010018) has the molecular formula C25H20ClFN2O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is (3-chlorophenyl)-[1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | 2-(3-Chlorobenzoyl)-1-(4-fluorophenyl)-6-methoxy-1H,2H,3H,4H,9H-pyrido[3,4-B]indole |
|---|---|
| PubChem CID | 16010018 |
| Molecular Formula | C25H20ClFN2O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (3-chlorophenyl)-[1-(4-fluorophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COC1=CC2=C(C=C1)NC3=C2CCN(C3C4=CC=C(C=C4)F)C(=O)C5=CC(=CC=C5)Cl |
| InChI | InChI=1S/C25H20ClFN2O2/c1-31-19-9-10-22-21(14-19)20-11-12-29(25(30)16-3-2-4-17(26)13-16)24(23(20)28-22)15-5-7-18(27)8-6-15/h2-10,13-14,24,28H,11-12H2,1H3 |
| InChIKey | OMBJYXMBQDJSMW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 45.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | 643 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|