About 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine
1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine (PubChem CID 16024868) has the molecular formula C19H25N3O2S
and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-(4-methylpiperidin-1-yl)-2-[[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine |
| PubChem CID | 16024868 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-(4-methylpiperidin-1-yl)-2-[[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]sulfanyl]ethanone |
| SMILES | CC1CCN(CC1)C(=O)CSC2=NC(=NO2)C3=CC=C(C=C3)C(C)C |
| InChI | InChI=1S/C19H25N3O2S/c1-13(2)15-4-6-16(7-5-15)18-20-19(24-21-18)25-12-17(23)22-10-8-14(3)9-11-22/h4-7,13-14H,8-12H2,1-3H3 |
| InChIKey | HKTIQFRJHLRWHZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 432 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine?
The IUPAC name of 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine (CID 16024868) is 1-(4-methylpiperidin-1-yl)-2-[[3-(4-propan-2-ylphenyl)-1,2,4-oxadiazol-5-yl]sulfanyl]ethanone.
What is the SMILES notation for 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine?
The canonical SMILES for 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine is CC1CCN(CC1)C(=O)CSC2=NC(=NO2)C3=CC=C(C=C3)C(C)C.
What is the InChIKey of 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine?
The InChIKey is HKTIQFRJHLRWHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O2S/c1-13(2)15-4-6-16(7-5-15)18-20-19(24-21-18)25-12-17(23)22-10-8-14(3)9-11-22/h4-7,13-14H,8-12H2,1-3H3.
What are the key properties of 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine?
1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine has a molecular weight of 359.50 g/mol, XLogP of 4.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-({[3-(4-Isopropylphenyl)-1,2,4-oxadiazol-5-yl]thio}acetyl)-4-methylpiperidine is sourced from PubChem (CID 16024868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).