About tetrabutylazanium
tetrabutylazanium (PubChem CID 16028) has the molecular formula C16H36N+
and a molecular weight of 242.47 g/mol. Its IUPAC name is tetrabutylazanium.
Molecular Properties
| Compound Name | tetrabutylazanium |
| PubChem CID | 16028 |
| Molecular Formula | C16H36N+ |
| Molecular Weight | 242.47 g/mol |
| Exact Mass | 242.28 |
| IUPAC Name | tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H3/q+1 |
| InChIKey | DZLFLBLQUQXARW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium?
The IUPAC name of tetrabutylazanium (CID 16028) is tetrabutylazanium.
What is the SMILES notation for tetrabutylazanium?
The canonical SMILES for tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of tetrabutylazanium?
The InChIKey is DZLFLBLQUQXARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H3/q+1.
What are the key properties of tetrabutylazanium?
tetrabutylazanium has a molecular weight of 242.47 g/mol, XLogP of 5.00, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium is sourced from PubChem (CID 16028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).