C19H17NO7S3 — CID 160500165
1-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylmethyl)phenyl]ethenyl]pyrrolidine-2,3,5-trione (PubChem CID 160500165) has the molecular formula C19H17NO7S3 and a molecular weight of 467.55 g/mol. Its IUPAC name is 1-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylmethyl)phenyl]ethenyl]pyrrolidine-2,3,5-trione.
| Compound Name | 1-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylmethyl)phenyl]ethenyl]pyrrolidine-2,3,5-trione |
|---|---|
| PubChem CID | 160500165 |
| Molecular Formula | C19H17NO7S3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.02 |
| IUPAC Name | 1-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylmethyl)phenyl]ethenyl]pyrrolidine-2,3,5-trione |
| SMILES | COc1cc(CS(=O)(=O)c2cccs2)c(SC)c(/C=C/N2C(=O)CC(=O)C2=O)c1O |
| InChI | InChI=1S/C19H17NO7S3/c1-27-14-8-11(10-30(25,26)16-4-3-7-29-16)18(28-2)12(17(14)23)5-6-20-15(22)9-13(21)19(20)24/h3-8,23H,9-10H2,1-2H3/b6-5+ |
| InChIKey | QRRIEWHUFUNUIP-AATRIKPKSA-N |
| XLogP | 2.46 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|