C26H27N3O6 — CID 160501242
(3R)-2-[[4-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]pyrazolidine-3-carboxylic acid (PubChem CID 160501242) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is (3R)-2-[[4-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]pyrazolidine-3-carboxylic acid.
| Compound Name | (3R)-2-[[4-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]pyrazolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 160501242 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | (3R)-2-[[4-[[2-(2,4-dioxocyclohexyl)-1-oxo-3H-isoindol-4-yl]oxymethyl]phenyl]methyl]pyrazolidine-3-carboxylic acid |
| SMILES | O=C1CCC(N2Cc3c(OCc4ccc(CN5NCC[C@@H]5C(=O)O)cc4)cccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C26H27N3O6/c30-18-8-9-21(23(31)12-18)28-14-20-19(25(28)32)2-1-3-24(20)35-15-17-6-4-16(5-7-17)13-29-22(26(33)34)10-11-27-29/h1-7,21-22,27H,8-15H2,(H,33,34)/t21?,22-/m1/s1 |
| InChIKey | ZXFRRASYDOTTID-FOIFJWKZSA-N |
| XLogP | 2.08 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|