About bis(pyridine);tetrafluoroborate
bis(pyridine);tetrafluoroborate (PubChem CID 160501590) has the molecular formula C10H10BF4N2-
and a molecular weight of 245.01 g/mol. Its IUPAC name is bis(pyridine);tetrafluoroborate.
Molecular Properties
| Compound Name | bis(pyridine);tetrafluoroborate |
| PubChem CID | 160501590 |
| Molecular Formula | C10H10BF4N2- |
| Molecular Weight | 245.01 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | bis(pyridine);tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccncc1.c1ccncc1 |
| InChI | InChI=1S/2C5H5N.BF4/c2*1-2-4-6-5-3-1;2-1(3,4)5/h2*1-5H;/q;;-1 |
| InChIKey | QRVVSKAJPXOXTK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.01 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(pyridine);tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(pyridine);tetrafluoroborate?
The IUPAC name of bis(pyridine);tetrafluoroborate (CID 160501590) is bis(pyridine);tetrafluoroborate.
What is the SMILES notation for bis(pyridine);tetrafluoroborate?
The canonical SMILES for bis(pyridine);tetrafluoroborate is F[B-](F)(F)F.c1ccncc1.c1ccncc1.
What is the InChIKey of bis(pyridine);tetrafluoroborate?
The InChIKey is QRVVSKAJPXOXTK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H5N.BF4/c2*1-2-4-6-5-3-1;2-1(3,4)5/h2*1-5H;/q;;-1.
What are the key properties of bis(pyridine);tetrafluoroborate?
bis(pyridine);tetrafluoroborate has a molecular weight of 245.01 g/mol, XLogP of 3.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(pyridine);tetrafluoroborate is sourced from PubChem (CID 160501590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).