C21H24I3O2- — CID 160502444
1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol triiodide (PubChem CID 160502444) has the molecular formula C21H24I3O2- and a molecular weight of 689.13 g/mol. Its IUPAC name is 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol triiodide.
| Compound Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol triiodide |
|---|---|
| PubChem CID | 160502444 |
| Molecular Formula | C21H24I3O2- |
| Molecular Weight | 689.13 g/mol |
| Exact Mass | 688.89 |
| IUPAC Name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol triiodide |
| SMILES | CC1(C)CC2(CC(C)(C)c3ccc(O)cc32)c2cc(O)ccc21.I[I-]I |
| InChI | InChI=1S/C21H24O2.I3/c1-19(2)11-21(17-9-13(22)5-7-15(17)19)12-20(3,4)16-8-6-14(23)10-18(16)21;1-3-2/h5-10,22-23H,11-12H2,1-4H3;/q;-1 |
| InChIKey | MCACQJVWLMINIS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.13 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|