About CID 160503051
CID 160503051 (PubChem CID 160503051) has the molecular formula C38H22BBr2Cl3F3O6
and a molecular weight of 908.56 g/mol.
Molecular Properties
| Compound Name | CID 160503051 |
| PubChem CID | 160503051 |
| Molecular Formula | C38H22BBr2Cl3F3O6 |
| Molecular Weight | 908.56 g/mol |
| Exact Mass | 904.89 |
| IUPAC Name | — |
| SMILES | O[B]Oc1ccc(Cl)cc1F.Oc1cc2cc(O)c(-c3ccc(Cl)cc3F)cc2cc1-c1ccc(Cl)cc1F.Oc1cc2cc(O)c(Br)cc2cc1Br |
| InChI | InChI=1S/C22H12Cl2F2O2.C10H6Br2O2.C6H4BClFO2/c23-13-1-3-15(19(25)9-13)17-5-11-6-18(16-4-2-14(24)10-20(16)26)22(28)8-12(11)7-21(17)27;11-7-1-5-2-8(12)10(14)4-6(5)3-9(7)13;8-4-1-2-6(11-7-10)5(9)3-4/h1-10,27-28H;1-4,13-14H;1-3,10H |
| InChIKey | JJXGSIVKDVVDNI-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 908.56 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 160503051 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160503051?
The IUPAC name of CID 160503051 (CID 160503051) is not available.
What is the SMILES notation for CID 160503051?
The canonical SMILES for CID 160503051 is O[B]Oc1ccc(Cl)cc1F.Oc1cc2cc(O)c(-c3ccc(Cl)cc3F)cc2cc1-c1ccc(Cl)cc1F.Oc1cc2cc(O)c(Br)cc2cc1Br.
What is the InChIKey of CID 160503051?
The InChIKey is JJXGSIVKDVVDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12Cl2F2O2.C10H6Br2O2.C6H4BClFO2/c23-13-1-3-15(19(25)9-13)17-5-11-6-18(16-4-2-14(24)10-20(16)26)22(28)8-12(11)7-21(17)27;11-7-1-5-2-8(12)10(14)4-6(5)3-9(7)13;8-4-1-2-6(11-7-10)5(9)3-4/h1-10,27-28H;1-4,13-14H;1-3,10H.
What are the key properties of CID 160503051?
CID 160503051 has a molecular weight of 908.56 g/mol, XLogP of 12.33, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160503051 is sourced from PubChem (CID 160503051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).