C30H29ClN2O4 — CID 160503406
methyl (1R,9R,10S,11R,12R)-14-(chloromethyl)-12-hydroxy-3,5-dimethyl-9-(4-methylphenyl)-10-phenyl-8-oxa-13,15-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,14-tetraene-11-carboxylate (PubChem CID 160503406) has the molecular formula C30H29ClN2O4 and a molecular weight of 517.03 g/mol. Its IUPAC name is methyl (1R,9R,10S,11R,12R)-14-(chloromethyl)-12-hydroxy-3,5-dimethyl-9-(4-methylphenyl)-10-phenyl-8-oxa-13,15-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,14-tetraene-11-carboxylate.
| Compound Name | methyl (1R,9R,10S,11R,12R)-14-(chloromethyl)-12-hydroxy-3,5-dimethyl-9-(4-methylphenyl)-10-phenyl-8-oxa-13,15-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,14-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 160503406 |
| Molecular Formula | C30H29ClN2O4 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | methyl (1R,9R,10S,11R,12R)-14-(chloromethyl)-12-hydroxy-3,5-dimethyl-9-(4-methylphenyl)-10-phenyl-8-oxa-13,15-diazatetracyclo[7.6.0.01,12.02,7]pentadeca-2,4,6,14-tetraene-11-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@]2(c3ccc(C)cc3)Oc3cc(C)cc(C)c3[C@@]23N=C(CCl)N[C@@]13O |
| InChI | InChI=1S/C30H29ClN2O4/c1-17-10-12-21(13-11-17)28-25(20-8-6-5-7-9-20)26(27(34)36-4)30(35)29(28,32-23(16-31)33-30)24-19(3)14-18(2)15-22(24)37-28/h5-15,25-26,35H,16H2,1-4H3,(H,32,33)/t25-,26+,28+,29-,30-/m1/s1 |
| InChIKey | RDAZURZKSSOENU-YGWVCABGSA-N |
| XLogP | 4.61 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|