C28H28N2O6S3 — CID 160503977
N-(4-ethylphenyl)-3-[3-[(4-ethylphenyl)sulfamoyl]phenyl]sulfonylbenzenesulfonamide (PubChem CID 160503977) has the molecular formula C28H28N2O6S3 and a molecular weight of 584.74 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-[3-[(4-ethylphenyl)sulfamoyl]phenyl]sulfonylbenzenesulfonamide.
| Compound Name | N-(4-ethylphenyl)-3-[3-[(4-ethylphenyl)sulfamoyl]phenyl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 160503977 |
| Molecular Formula | C28H28N2O6S3 |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.11 |
| IUPAC Name | N-(4-ethylphenyl)-3-[3-[(4-ethylphenyl)sulfamoyl]phenyl]sulfonylbenzenesulfonamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2cccc(S(=O)(=O)c3cccc(S(=O)(=O)Nc4ccc(CC)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C28H28N2O6S3/c1-3-21-11-15-23(16-12-21)29-38(33,34)27-9-5-7-25(19-27)37(31,32)26-8-6-10-28(20-26)39(35,36)30-24-17-13-22(4-2)14-18-24/h5-20,29-30H,3-4H2,1-2H3 |
| InChIKey | DIOVQBFFKPPEMA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |