C20H31N4O6-3 — CID 160504488
2-[2-[2-[(4-aminophenyl)methyl-(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]ethyl-ethylamino]acetate;methane (PubChem CID 160504488) has the molecular formula C20H31N4O6-3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 2-[2-[2-[(4-aminophenyl)methyl-(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]ethyl-ethylamino]acetate;methane.
| Compound Name | 2-[2-[2-[(4-aminophenyl)methyl-(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]ethyl-ethylamino]acetate;methane |
|---|---|
| PubChem CID | 160504488 |
| Molecular Formula | C20H31N4O6-3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-[2-[2-[(4-aminophenyl)methyl-(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]ethyl-ethylamino]acetate;methane |
| SMILES | C.CCN(CCN(CCN(CC(=O)[O-])Cc1ccc(N)cc1)CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C19H30N4O6.CH4/c1-2-21(12-17(24)25)7-8-22(13-18(26)27)9-10-23(14-19(28)29)11-15-3-5-16(20)6-4-15;/h3-6H,2,7-14,20H2,1H3,(H,24,25)(H,26,27)(H,28,29);1H4/p-3 |
| InChIKey | QSFFBUZVQAALRP-UHFFFAOYSA-K |
| XLogP | -3.42 |
| TPSA | 156.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|