C23H38O5Si — CID 160505287
6-(furan-2-yl)hexoxy-trimethylsilane;1-(furan-2-yl)-6-hydroxyhexan-1-one (PubChem CID 160505287) has the molecular formula C23H38O5Si and a molecular weight of 422.64 g/mol. Its IUPAC name is 6-(furan-2-yl)hexoxy-trimethylsilane;1-(furan-2-yl)-6-hydroxyhexan-1-one.
| Compound Name | 6-(furan-2-yl)hexoxy-trimethylsilane;1-(furan-2-yl)-6-hydroxyhexan-1-one |
|---|---|
| PubChem CID | 160505287 |
| Molecular Formula | C23H38O5Si |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 6-(furan-2-yl)hexoxy-trimethylsilane;1-(furan-2-yl)-6-hydroxyhexan-1-one |
| SMILES | C[Si](C)(C)OCCCCCCc1ccco1.O=C(CCCCCO)c1ccco1 |
| InChI | InChI=1S/C13H24O2Si.C10H14O3/c1-16(2,3)15-12-7-5-4-6-9-13-10-8-11-14-13;11-7-3-1-2-5-9(12)10-6-4-8-13-10/h8,10-11H,4-7,9,12H2,1-3H3;4,6,8,11H,1-3,5,7H2 |
| InChIKey | QSHXQURKOKISPW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|