About potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene
potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene (PubChem CID 160506444) has the molecular formula C13H21KO
and a molecular weight of 232.41 g/mol. Its IUPAC name is potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene |
| PubChem CID | 160506444 |
| Molecular Formula | C13H21KO |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene |
| SMILES | CC(C)(C)[O-].Cc1cc(C)cc(C)c1.[K+] |
| InChI | InChI=1S/C9H12.C4H9O.K/c1-7-4-8(2)6-9(3)5-7;1-4(2,3)5;/h4-6H,1-3H3;1-3H3;/q;-1;+1 |
| InChIKey | QSLXBZBOAFVUQR-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene?
The IUPAC name of potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene (CID 160506444) is potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene.
What is the SMILES notation for potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene?
The canonical SMILES for potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene is CC(C)(C)[O-].Cc1cc(C)cc(C)c1.[K+].
What is the InChIKey of potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene?
The InChIKey is QSLXBZBOAFVUQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C4H9O.K/c1-7-4-8(2)6-9(3)5-7;1-4(2,3)5;/h4-6H,1-3H3;1-3H3;/q;-1;+1.
What are the key properties of potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene?
potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene has a molecular weight of 232.41 g/mol, XLogP of -0.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-methylpropan-2-olate;1,3,5-trimethylbenzene is sourced from PubChem (CID 160506444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).