C30H26F6N2O — CID 160506758
aniline;N-phenyl-1-(2,4,6-trifluorophenyl)propan-1-imine;1-(2,4,6-trifluorophenyl)propan-1-one (PubChem CID 160506758) has the molecular formula C30H26F6N2O and a molecular weight of 544.54 g/mol. Its IUPAC name is aniline;N-phenyl-1-(2,4,6-trifluorophenyl)propan-1-imine;1-(2,4,6-trifluorophenyl)propan-1-one.
| Compound Name | aniline;N-phenyl-1-(2,4,6-trifluorophenyl)propan-1-imine;1-(2,4,6-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 160506758 |
| Molecular Formula | C30H26F6N2O |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.19 |
| IUPAC Name | aniline;N-phenyl-1-(2,4,6-trifluorophenyl)propan-1-imine;1-(2,4,6-trifluorophenyl)propan-1-one |
| SMILES | CC/C(=N\c1ccccc1)c1c(F)cc(F)cc1F.CCC(=O)c1c(F)cc(F)cc1F.Nc1ccccc1 |
| InChI | InChI=1S/C15H12F3N.C9H7F3O.C6H7N/c1-2-14(19-11-6-4-3-5-7-11)15-12(17)8-10(16)9-13(15)18;1-2-8(13)9-6(11)3-5(10)4-7(9)12;7-6-4-2-1-3-5-6/h3-9H,2H2,1H3;3-4H,2H2,1H3;1-5H,7H2/b19-14+;; |
| InChIKey | QSMXLVLKKDNUTG-ZWXFCGGNSA-N |
| XLogP | 8.60 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|