C27H33ClN6O2Si — CID 160509477
N-[4-chloro-3-[5-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 160509477) has the molecular formula C27H33ClN6O2Si and a molecular weight of 537.14 g/mol. Its IUPAC name is N-[4-chloro-3-[5-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[4-chloro-3-[5-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 160509477 |
| Molecular Formula | C27H33ClN6O2Si |
| Molecular Weight | 537.14 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-[4-chloro-3-[5-[1-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-3H-pyrrolo[2,3-b]pyridin-2-yl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1cnc(-c2cnc3c(c2)CC(c2cc(NC(=O)N4CCCC4)ccc2Cl)=N3)c1 |
| InChI | InChI=1S/C27H33ClN6O2Si/c1-37(2,3)11-10-36-18-33-16-25(30-17-33)20-12-19-13-24(32-26(19)29-15-20)22-14-21(6-7-23(22)28)31-27(35)34-8-4-5-9-34/h6-7,12,14-17H,4-5,8-11,13,18H2,1-3H3,(H,31,35) |
| InChIKey | QSVVPYXPPJVOQA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.14 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|