About 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide
3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide (PubChem CID 160510186) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide |
| PubChem CID | 160510186 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide |
| SMILES | CCOCC(C)(C)C(=O)N(C)C(C)C |
| InChI | InChI=1S/C11H23NO2/c1-7-14-8-11(4,5)10(13)12(6)9(2)3/h9H,7-8H2,1-6H3 |
| InChIKey | ZJAARRZIZZPAAR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide?
The IUPAC name of 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide (CID 160510186) is 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide.
What is the SMILES notation for 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide?
The canonical SMILES for 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide is CCOCC(C)(C)C(=O)N(C)C(C)C.
What is the InChIKey of 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide?
The InChIKey is ZJAARRZIZZPAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-7-14-8-11(4,5)10(13)12(6)9(2)3/h9H,7-8H2,1-6H3.
What are the key properties of 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide?
3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide has a molecular weight of 201.31 g/mol, XLogP of 1.92, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N,2,2-trimethyl-N-propan-2-ylpropanamide is sourced from PubChem (CID 160510186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).