C34H18O18 — CID 160511178
4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;5-(2,5-dioxooxolan-3-yl)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone (PubChem CID 160511178) has the molecular formula C34H18O18 and a molecular weight of 714.50 g/mol. Its IUPAC name is 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;5-(2,5-dioxooxolan-3-yl)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone.
| Compound Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;5-(2,5-dioxooxolan-3-yl)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 160511178 |
| Molecular Formula | C34H18O18 |
| Molecular Weight | 714.50 g/mol |
| Exact Mass | 714.05 |
| IUPAC Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone;5-(2,5-dioxooxolan-3-yl)-3a,4,5,9b-tetrahydrobenzo[e][2]benzofuran-1,3-dione;furo[3,4-f][2]benzofuran-1,3,5,7-tetrone |
| SMILES | O=C1CC(C2CC3C(=O)OC(=O)C3c3ccccc32)C(=O)O1.O=C1OC(=O)C2C1C1C(=O)OC(=O)C21.O=c1oc(=O)c2cc3c(=O)oc(=O)c3cc12 |
| InChI | InChI=1S/C16H12O6.C10H2O6.C8H4O6/c17-12-6-10(14(18)21-12)9-5-11-13(16(20)22-15(11)19)8-4-2-1-3-7(8)9;11-7-3-1-4-6(10(14)16-8(4)12)2-5(3)9(13)15-7;9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4,9-11,13H,5-6H2;1-2H;1-4H |
| InChIKey | QTBHOJIQFPUSMO-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 268.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.50 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|