About (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide
(E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide (PubChem CID 160512013) has the molecular formula C9H16N2O4S
and a molecular weight of 248.30 g/mol. Its IUPAC name is (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide.
Molecular Properties
| Compound Name | (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide |
| PubChem CID | 160512013 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide |
| SMILES | C/C=C/C(=O)NS(C)(=O)=O.C/C=C/C(N)=O |
| InChI | InChI=1S/C5H9NO3S.C4H7NO/c1-3-4-5(7)6-10(2,8)9;1-2-3-4(5)6/h3-4H,1-2H3,(H,6,7);2-3H,1H3,(H2,5,6)/b4-3+;3-2+ |
| InChIKey | QTEAARNPUSYSCT-VWJMYZPHSA-N |
| XLogP | -0.31 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide?
The IUPAC name of (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide (CID 160512013) is (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide.
What is the SMILES notation for (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide?
The canonical SMILES for (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide is C/C=C/C(=O)NS(C)(=O)=O.C/C=C/C(N)=O.
What is the InChIKey of (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide?
The InChIKey is QTEAARNPUSYSCT-VWJMYZPHSA-N. The full InChI is InChI=1S/C5H9NO3S.C4H7NO/c1-3-4-5(7)6-10(2,8)9;1-2-3-4(5)6/h3-4H,1-2H3,(H,6,7);2-3H,1H3,(H2,5,6)/b4-3+;3-2+.
What are the key properties of (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide?
(E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide has a molecular weight of 248.30 g/mol, XLogP of -0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enamide;(E)-N-methylsulfonylbut-2-enamide is sourced from PubChem (CID 160512013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).