C20H26F3NO4 — CID 160513158
[(4bS,8S,8aR)-8-methoxycarbonyl-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]azanium;2,2,2-trifluoroacetate (PubChem CID 160513158) has the molecular formula C20H26F3NO4 and a molecular weight of 401.43 g/mol. Its IUPAC name is [(4bS,8S,8aR)-8-methoxycarbonyl-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(4bS,8S,8aR)-8-methoxycarbonyl-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160513158 |
| Molecular Formula | C20H26F3NO4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(4bS,8S,8aR)-8-methoxycarbonyl-4b,8-dimethyl-5,6,7,8a,9,10-hexahydrophenanthren-3-yl]azanium;2,2,2-trifluoroacetate |
| SMILES | COC(=O)[C@@]1(C)CCC[C@]2(C)c3cc([NH3+])ccc3CC[C@@H]12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H25NO2.C2HF3O2/c1-17-9-4-10-18(2,16(20)21-3)15(17)8-6-12-5-7-13(19)11-14(12)17;3-2(4,5)1(6)7/h5,7,11,15H,4,6,8-10,19H2,1-3H3;(H,6,7)/t15-,17-,18+;/m1./s1 |
| InChIKey | GDQWYFGNXMYNPB-ZDJZOQRLSA-N |
| XLogP | 2.04 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |