About nitrosourea;nitrourea
nitrosourea;nitrourea (PubChem CID 160513443) has the molecular formula C2H6N6O5
and a molecular weight of 194.11 g/mol. Its IUPAC name is nitrosourea;nitrourea.
Molecular Properties
| Compound Name | nitrosourea;nitrourea |
| PubChem CID | 160513443 |
| Molecular Formula | C2H6N6O5 |
| Molecular Weight | 194.11 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | nitrosourea;nitrourea |
| SMILES | NC(=O)NN=O.NC(=O)N[N+](=O)[O-] |
| InChI | InChI=1S/CH3N3O3.CH3N3O2/c2-1(5)3-4(6)7;2-1(5)3-4-6/h(H3,2,3,5);(H3,2,3,5,6) |
| InChIKey | QTILRWYIYBSLBF-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 182.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.11 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrosourea;nitrourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrosourea;nitrourea?
The IUPAC name of nitrosourea;nitrourea (CID 160513443) is nitrosourea;nitrourea.
What is the SMILES notation for nitrosourea;nitrourea?
The canonical SMILES for nitrosourea;nitrourea is NC(=O)NN=O.NC(=O)N[N+](=O)[O-].
What is the InChIKey of nitrosourea;nitrourea?
The InChIKey is QTILRWYIYBSLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3N3O3.CH3N3O2/c2-1(5)3-4(6)7;2-1(5)3-4-6/h(H3,2,3,5);(H3,2,3,5,6).
What are the key properties of nitrosourea;nitrourea?
nitrosourea;nitrourea has a molecular weight of 194.11 g/mol, XLogP of -1.82, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitrosourea;nitrourea is sourced from PubChem (CID 160513443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).