About 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane
7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane (PubChem CID 160515797) has the molecular formula C22H17Br2N5O2
and a molecular weight of 543.22 g/mol. Its IUPAC name is 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane.
Molecular Properties
| Compound Name | 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane |
| PubChem CID | 160515797 |
| Molecular Formula | C22H17Br2N5O2 |
| Molecular Weight | 543.22 g/mol |
| Exact Mass | 540.97 |
| IUPAC Name | 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane |
| SMILES | C1CCOC1.O=Cc1cnc2ccc(Br)cc2n1.[C-]#[N+]c1cnc2ccc(Br)cc2n1 |
| InChI | InChI=1S/C9H4BrN3.C9H5BrN2O.C4H8O/c1-11-9-5-12-7-3-2-6(10)4-8(7)13-9;10-6-1-2-8-9(3-6)12-7(5-13)4-11-8;1-2-4-5-3-1/h2-5H;1-5H;1-4H2 |
| InChIKey | QTQGZKQWBFCYAN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 82.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.22 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane?
The IUPAC name of 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane (CID 160515797) is 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane.
What is the SMILES notation for 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane?
The canonical SMILES for 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane is C1CCOC1.O=Cc1cnc2ccc(Br)cc2n1.[C-]#[N+]c1cnc2ccc(Br)cc2n1.
What is the InChIKey of 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane?
The InChIKey is QTQGZKQWBFCYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrN3.C9H5BrN2O.C4H8O/c1-11-9-5-12-7-3-2-6(10)4-8(7)13-9;10-6-1-2-8-9(3-6)12-7(5-13)4-11-8;1-2-4-5-3-1/h2-5H;1-5H;1-4H2.
What are the key properties of 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane?
7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane has a molecular weight of 543.22 g/mol, XLogP of 5.94, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-isocyanoquinoxaline;7-bromoquinoxaline-2-carbaldehyde;oxolane is sourced from PubChem (CID 160515797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).