C22H44N4O — CID 160515819
6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;3-tert-butyl-8-methyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 160515819) has the molecular formula C22H44N4O and a molecular weight of 380.62 g/mol. Its IUPAC name is 6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;3-tert-butyl-8-methyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;3-tert-butyl-8-methyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 160515819 |
| Molecular Formula | C22H44N4O |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.35 |
| IUPAC Name | 6-tert-butyl-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine;3-tert-butyl-8-methyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CN1C2CCC1CN(C(C)(C)C)C2.CN1CCOC2CN(C(C)(C)C)CC21 |
| InChI | InChI=1S/C11H22N2O.C11H22N2/c1-11(2,3)13-7-9-10(8-13)14-6-5-12(9)4;1-11(2,3)13-7-9-5-6-10(8-13)12(9)4/h9-10H,5-8H2,1-4H3;9-10H,5-8H2,1-4H3 |
| InChIKey | QTQIGYKDWIPMJT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |