About benzene;4-methylbenzenediazonium
benzene;4-methylbenzenediazonium (PubChem CID 160516571) has the molecular formula C13H13N2+
and a molecular weight of 197.26 g/mol. Its IUPAC name is benzene;4-methylbenzenediazonium.
Molecular Properties
| Compound Name | benzene;4-methylbenzenediazonium |
| PubChem CID | 160516571 |
| Molecular Formula | C13H13N2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | benzene;4-methylbenzenediazonium |
| SMILES | Cc1ccc([N+]#N)cc1.c1ccccc1 |
| InChI | InChI=1S/C7H7N2.C6H6/c1-6-2-4-7(9-8)5-3-6;1-2-4-6-5-3-1/h2-5H,1H3;1-6H/q+1; |
| InChIKey | QTSULTXWIZLCRC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze benzene;4-methylbenzenediazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;4-methylbenzenediazonium?
The IUPAC name of benzene;4-methylbenzenediazonium (CID 160516571) is benzene;4-methylbenzenediazonium.
What is the SMILES notation for benzene;4-methylbenzenediazonium?
The canonical SMILES for benzene;4-methylbenzenediazonium is Cc1ccc([N+]#N)cc1.c1ccccc1.
What is the InChIKey of benzene;4-methylbenzenediazonium?
The InChIKey is QTSULTXWIZLCRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2.C6H6/c1-6-2-4-7(9-8)5-3-6;1-2-4-6-5-3-1/h2-5H,1H3;1-6H/q+1;.
What are the key properties of benzene;4-methylbenzenediazonium?
benzene;4-methylbenzenediazonium has a molecular weight of 197.26 g/mol, XLogP of 4.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;4-methylbenzenediazonium is sourced from PubChem (CID 160516571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).