C40H46O2 — CID 160518124
1-tert-butyl-9,10-bis[(4-tert-butylphenyl)methoxy]anthracene (PubChem CID 160518124) has the molecular formula C40H46O2 and a molecular weight of 558.81 g/mol. Its IUPAC name is 1-tert-butyl-9,10-bis[(4-tert-butylphenyl)methoxy]anthracene.
| Compound Name | 1-tert-butyl-9,10-bis[(4-tert-butylphenyl)methoxy]anthracene |
|---|---|
| PubChem CID | 160518124 |
| Molecular Formula | C40H46O2 |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 1-tert-butyl-9,10-bis[(4-tert-butylphenyl)methoxy]anthracene |
| SMILES | CC(C)(C)c1ccc(COc2c3ccccc3c(OCc3ccc(C(C)(C)C)cc3)c3c(C(C)(C)C)cccc23)cc1 |
| InChI | InChI=1S/C40H46O2/c1-38(2,3)29-21-17-27(18-22-29)25-41-36-31-13-10-11-14-32(31)37(35-33(36)15-12-16-34(35)40(7,8)9)42-26-28-19-23-30(24-20-28)39(4,5)6/h10-24H,25-26H2,1-9H3 |
| InChIKey | QTXPQFWJGNZGHI-UHFFFAOYSA-N |
| XLogP | 11.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|