About ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole
ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole (PubChem CID 160518148) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole.
Molecular Properties
| Compound Name | ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole |
| PubChem CID | 160518148 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole |
| SMILES | C=CC(=O)OCC.CSc1ncc[nH]1 |
| InChI | InChI=1S/C5H8O2.C4H6N2S/c1-3-5(6)7-4-2;1-7-4-5-2-3-6-4/h3H,1,4H2,2H3;2-3H,1H3,(H,5,6) |
| InChIKey | QTXRNUXFCMZYKC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole?
The IUPAC name of ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole (CID 160518148) is ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole.
What is the SMILES notation for ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole?
The canonical SMILES for ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole is C=CC(=O)OCC.CSc1ncc[nH]1.
What is the InChIKey of ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole?
The InChIKey is QTXRNUXFCMZYKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6N2S/c1-3-5(6)7-4-2;1-7-4-5-2-3-6-4/h3H,1,4H2,2H3;2-3H,1H3,(H,5,6).
What are the key properties of ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole?
ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole has a molecular weight of 214.29 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl prop-2-enoate;2-methylsulfanyl-1H-imidazole is sourced from PubChem (CID 160518148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).