C13H14FN3O2 — CID 160519213
N-[(2S)-3-fluoro-1-hydroxy-3-methylbutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide (PubChem CID 160519213) has the molecular formula C13H14FN3O2 and a molecular weight of 263.27 g/mol. Its IUPAC name is N-[(2S)-3-fluoro-1-hydroxy-3-methylbutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide.
| Compound Name | N-[(2S)-3-fluoro-1-hydroxy-3-methylbutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 160519213 |
| Molecular Formula | C13H14FN3O2 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-[(2S)-3-fluoro-1-hydroxy-3-methylbutan-2-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1,4,6,8-tetraene-7-carboxamide |
| SMILES | CC(C)(F)[C@H](CO)NC(=O)C1=C2C=C3CC3=C2N=N1 |
| InChI | InChI=1S/C13H14FN3O2/c1-13(2,14)9(5-18)15-12(19)11-8-4-6-3-7(6)10(8)16-17-11/h4,9,18H,3,5H2,1-2H3,(H,15,19)/t9-/m0/s1 |
| InChIKey | QUBAPZCYGDUKPI-VIFPVBQESA-N |
| XLogP | 1.53 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |