About 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate
4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate (PubChem CID 160520236) has the molecular formula C25H19BrF2N2O6
and a molecular weight of 561.34 g/mol. Its IUPAC name is 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate.
Molecular Properties
| Compound Name | 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate |
| PubChem CID | 160520236 |
| Molecular Formula | C25H19BrF2N2O6 |
| Molecular Weight | 561.34 g/mol |
| Exact Mass | 560.04 |
| IUPAC Name | 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(Br)n1.O=C(O)c1cccc(Oc2ccc(F)cc2)n1.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C12H8FNO3.C7H6BrNO2.C6H5FO/c13-8-4-6-9(7-5-8)17-11-3-1-2-10(14-11)12(15)16;1-11-7(10)5-3-2-4-6(8)9-5;7-5-1-3-6(8)4-2-5/h1-7H,(H,15,16);2-4H,1H3;1-4,8H |
| InChIKey | QUEFNBAHMHJIDO-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.34 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate?
The IUPAC name of 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate (CID 160520236) is 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate.
What is the SMILES notation for 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate?
The canonical SMILES for 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate is COC(=O)c1cccc(Br)n1.O=C(O)c1cccc(Oc2ccc(F)cc2)n1.Oc1ccc(F)cc1.
What is the InChIKey of 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate?
The InChIKey is QUEFNBAHMHJIDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8FNO3.C7H6BrNO2.C6H5FO/c13-8-4-6-9(7-5-8)17-11-3-1-2-10(14-11)12(15)16;1-11-7(10)5-3-2-4-6(8)9-5;7-5-1-3-6(8)4-2-5/h1-7H,(H,15,16);2-4H,1H3;1-4,8H.
What are the key properties of 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate?
4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate has a molecular weight of 561.34 g/mol, XLogP of 5.87, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;6-(4-fluorophenoxy)pyridine-2-carboxylic acid;methyl 6-bromopyridine-2-carboxylate is sourced from PubChem (CID 160520236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).