About 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol
4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol (PubChem CID 160520447) has the molecular formula C25H28N6O2
and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol.
Molecular Properties
| Compound Name | 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol |
| PubChem CID | 160520447 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol |
| SMILES | CN1CCN(c2nnc(Nc3ccc(O)cc3)c3ccccc23)CC1.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C19H21N5O.C6H7NO/c1-23-10-12-24(13-11-23)19-17-5-3-2-4-16(17)18(21-22-19)20-14-6-8-15(25)9-7-14;7-5-1-3-6(8)4-2-5/h2-9,25H,10-13H2,1H3,(H,20,21);1-4,8H,7H2 |
| InChIKey | QUEWYJQXNWJREP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol?
The IUPAC name of 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol (CID 160520447) is 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol.
What is the SMILES notation for 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol?
The canonical SMILES for 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol is CN1CCN(c2nnc(Nc3ccc(O)cc3)c3ccccc23)CC1.Nc1ccc(O)cc1.
What is the InChIKey of 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol?
The InChIKey is QUEWYJQXNWJREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O.C6H7NO/c1-23-10-12-24(13-11-23)19-17-5-3-2-4-16(17)18(21-22-19)20-14-6-8-15(25)9-7-14;7-5-1-3-6(8)4-2-5/h2-9,25H,10-13H2,1H3,(H,20,21);1-4,8H,7H2.
What are the key properties of 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol?
4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol has a molecular weight of 444.54 g/mol, XLogP of 3.81, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;4-[[4-(4-methylpiperazin-1-yl)phthalazin-1-yl]amino]phenol is sourced from PubChem (CID 160520447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).