About pentachloro-λ5-stibane;trichlorostibane
pentachloro-λ5-stibane;trichlorostibane (PubChem CID 160520814) has the molecular formula Cl8Sb2
and a molecular weight of 527.14 g/mol. Its IUPAC name is pentachloro-λ5-stibane;trichlorostibane.
Molecular Properties
| Compound Name | pentachloro-λ5-stibane;trichlorostibane |
| PubChem CID | 160520814 |
| Molecular Formula | Cl8Sb2 |
| Molecular Weight | 527.14 g/mol |
| Exact Mass | 521.56 |
| IUPAC Name | pentachloro-λ5-stibane;trichlorostibane |
| SMILES | Cl[Sb](Cl)(Cl)(Cl)Cl.Cl[Sb](Cl)Cl |
| InChI | InChI=1S/8ClH.2Sb/h8*1H;;/q;;;;;;;;+3;+5/p-8 |
| InChIKey | QUFYQZKTUYSYER-UHFFFAOYSA-F |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 527.14 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze pentachloro-λ5-stibane;trichlorostibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentachloro-λ5-stibane;trichlorostibane?
The IUPAC name of pentachloro-λ5-stibane;trichlorostibane (CID 160520814) is pentachloro-λ5-stibane;trichlorostibane.
What is the SMILES notation for pentachloro-λ5-stibane;trichlorostibane?
The canonical SMILES for pentachloro-λ5-stibane;trichlorostibane is Cl[Sb](Cl)(Cl)(Cl)Cl.Cl[Sb](Cl)Cl.
What is the InChIKey of pentachloro-λ5-stibane;trichlorostibane?
The InChIKey is QUFYQZKTUYSYER-UHFFFAOYSA-F. The full InChI is InChI=1S/8ClH.2Sb/h8*1H;;/q;;;;;;;;+3;+5/p-8.
What are the key properties of pentachloro-λ5-stibane;trichlorostibane?
pentachloro-λ5-stibane;trichlorostibane has a molecular weight of 527.14 g/mol, XLogP of 4.75, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentachloro-λ5-stibane;trichlorostibane is sourced from PubChem (CID 160520814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).