C12H9F3N6O2 — CID 160520919
5-[3-(1H-imidazol-3-ium-3-yl)phenyl]-2H-tetrazole;2,2,2-trifluoroacetate (PubChem CID 160520919) has the molecular formula C12H9F3N6O2 and a molecular weight of 326.24 g/mol. Its IUPAC name is 5-[3-(1H-imidazol-3-ium-3-yl)phenyl]-2H-tetrazole;2,2,2-trifluoroacetate.
| Compound Name | 5-[3-(1H-imidazol-3-ium-3-yl)phenyl]-2H-tetrazole;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160520919 |
| Molecular Formula | C12H9F3N6O2 |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 5-[3-(1H-imidazol-3-ium-3-yl)phenyl]-2H-tetrazole;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.c1cc(-c2nn[nH]n2)cc(-[n+]2cc[nH]c2)c1 |
| InChI | InChI=1S/C10H8N6.C2HF3O2/c1-2-8(10-12-14-15-13-10)6-9(3-1)16-5-4-11-7-16;3-2(4,5)1(6)7/h1-7H,(H,12,13,14,15);(H,6,7) |
| InChIKey | QUGGLCRUAQWLQE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|