C26H44O6 — CID 160523034
methoxymethyl 4-[(3R,10S,12S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 160523034) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is methoxymethyl 4-[(3R,10S,12S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methoxymethyl 4-[(3R,10S,12S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 160523034 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | methoxymethyl 4-[(3R,10S,12S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COCOC(=O)CCC(C)C1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C26H44O6/c1-15(5-8-23(30)32-14-31-4)18-6-7-19-24-20(13-22(29)26(18,19)3)25(2)10-9-17(27)11-16(25)12-21(24)28/h15-22,24,27-29H,5-14H2,1-4H3/t15?,16?,17-,18?,19?,20?,21?,22+,24?,25+,26-/m1/s1 |
| InChIKey | FJDSXBXUKZEQRB-WGSOWWFRSA-N |
| XLogP | 3.51 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|