About (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane
(3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane (PubChem CID 160523765) has the molecular formula C12H26PW-
and a molecular weight of 385.15 g/mol. Its IUPAC name is (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane.
Molecular Properties
| Compound Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane |
| PubChem CID | 160523765 |
| Molecular Formula | C12H26PW- |
| Molecular Weight | 385.15 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane |
| SMILES | C.C.C.C.C.[H]/[C-]=C/C(C#C)=CC(P)=[W] |
| InChI | InChI=1S/C7H6P.5CH4.W/c1-3-7(4-2)5-6-8;;;;;;/h1-3,5H,8H2;5*1H4;/q-1;;;;;; |
| InChIKey | VLTKGWHOFZPKTJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.15 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane?
The IUPAC name of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane (CID 160523765) is (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane.
What is the SMILES notation for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane?
The canonical SMILES for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane is C.C.C.C.C.[H]/[C-]=C/C(C#C)=CC(P)=[W].
What is the InChIKey of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane?
The InChIKey is VLTKGWHOFZPKTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6P.5CH4.W/c1-3-7(4-2)5-6-8;;;;;;/h1-3,5H,8H2;5*1H4;/q-1;;;;;;.
What are the key properties of (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane?
(3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane has a molecular weight of 385.15 g/mol, XLogP of 4.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethynyl-1-phosphanylpenta-2,4-dienylidene)tungsten;methane is sourced from PubChem (CID 160523765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).