C22H29F17O3Si2 — CID 160523779
(4-dimethylsilylphenyl)-trimethylsilane;2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane;tetrafluoromethane (PubChem CID 160523779) has the molecular formula C22H29F17O3Si2 and a molecular weight of 720.61 g/mol. Its IUPAC name is (4-dimethylsilylphenyl)-trimethylsilane;2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane;tetrafluoromethane.
| Compound Name | (4-dimethylsilylphenyl)-trimethylsilane;2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane;tetrafluoromethane |
|---|---|
| PubChem CID | 160523779 |
| Molecular Formula | C22H29F17O3Si2 |
| Molecular Weight | 720.61 g/mol |
| Exact Mass | 720.14 |
| IUPAC Name | (4-dimethylsilylphenyl)-trimethylsilane;2-(3-ethoxy-1,1,1,2-tetrafluoropropan-2-yl)oxy-1,1,1,3,3,3-hexafluoro-2-(2,2,2-trifluoroethoxy)propane;tetrafluoromethane |
| SMILES | CCOCC(F)(OC(OCC(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)F.C[SiH](C)c1ccc([Si](C)(C)C)cc1.FC(F)(F)F |
| InChI | InChI=1S/C11H20Si2.C10H9F13O3.CF4/c1-12(2)10-6-8-11(9-7-10)13(3,4)5;1-2-24-3-5(11,8(15,16)17)26-7(9(18,19)20,10(21,22)23)25-4-6(12,13)14;2-1(3,4)5/h6-9,12H,1-5H3;2-4H2,1H3; |
| InChIKey | QUPZFCOGCCYQOZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.61 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|