C30H54N6O2 — CID 160526541
2,3,4-tris[(dimethylamino)methyl]phenol;2,4,6-tris[(dimethylamino)methyl]phenol (PubChem CID 160526541) has the molecular formula C30H54N6O2 and a molecular weight of 530.80 g/mol. Its IUPAC name is 2,3,4-tris[(dimethylamino)methyl]phenol;2,4,6-tris[(dimethylamino)methyl]phenol.
| Compound Name | 2,3,4-tris[(dimethylamino)methyl]phenol;2,4,6-tris[(dimethylamino)methyl]phenol |
|---|---|
| PubChem CID | 160526541 |
| Molecular Formula | C30H54N6O2 |
| Molecular Weight | 530.80 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | 2,3,4-tris[(dimethylamino)methyl]phenol;2,4,6-tris[(dimethylamino)methyl]phenol |
| SMILES | CN(C)Cc1cc(CN(C)C)c(O)c(CN(C)C)c1.CN(C)Cc1ccc(O)c(CN(C)C)c1CN(C)C |
| InChI | InChI=1S/2C15H27N3O/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6;1-16(2)9-12-7-8-15(19)14(11-18(5)6)13(12)10-17(3)4/h2*7-8,19H,9-11H2,1-6H3 |
| InChIKey | QUYYGORBPGRZJO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|