C20H21ClN6O3S — CID 160527051
5-chloro-N-[2-[1,4-dimethyl-5-(4-nitrophenyl)pyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;methane (PubChem CID 160527051) has the molecular formula C20H21ClN6O3S and a molecular weight of 460.95 g/mol. Its IUPAC name is 5-chloro-N-[2-[1,4-dimethyl-5-(4-nitrophenyl)pyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;methane.
| Compound Name | 5-chloro-N-[2-[1,4-dimethyl-5-(4-nitrophenyl)pyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;methane |
|---|---|
| PubChem CID | 160527051 |
| Molecular Formula | C20H21ClN6O3S |
| Molecular Weight | 460.95 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 5-chloro-N-[2-[1,4-dimethyl-5-(4-nitrophenyl)pyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;methane |
| SMILES | C.Cc1c(OCCNc2ncnc3scc(Cl)c23)nn(C)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17ClN6O3S.CH4/c1-11-16(12-3-5-13(6-4-12)26(27)28)25(2)24-18(11)29-8-7-21-17-15-14(20)9-30-19(15)23-10-22-17;/h3-6,9-10H,7-8H2,1-2H3,(H,21,22,23);1H4 |
| InChIKey | QVAUFAMRZVRFSM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.95 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|