C18H24N4O5 — CID 160527285
2-[11-tert-butyl-5-(1-methoxypropan-2-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid (PubChem CID 160527285) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[11-tert-butyl-5-(1-methoxypropan-2-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid.
| Compound Name | 2-[11-tert-butyl-5-(1-methoxypropan-2-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
|---|---|
| PubChem CID | 160527285 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[11-tert-butyl-5-(1-methoxypropan-2-yl)-2,6-dioxo-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-trien-8-yl]acetic acid |
| SMILES | COCC(C)N1Cc2c(n(CC(=O)O)c3cc(C(C)(C)C)nn3c2=O)C1=O |
| InChI | InChI=1S/C18H24N4O5/c1-10(9-27-5)20-7-11-15(17(20)26)21(8-14(23)24)13-6-12(18(2,3)4)19-22(13)16(11)25/h6,10H,7-9H2,1-5H3,(H,23,24) |
| InChIKey | QVBMVDQEBHGKPK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |