C14H22N6O4S — CID 160527837
N'-[2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]ethane-1,2-diamine;methyl sulfate (PubChem CID 160527837) has the molecular formula C14H22N6O4S and a molecular weight of 370.44 g/mol. Its IUPAC name is N'-[2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]ethane-1,2-diamine;methyl sulfate.
| Compound Name | N'-[2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]ethane-1,2-diamine;methyl sulfate |
|---|---|
| PubChem CID | 160527837 |
| Molecular Formula | C14H22N6O4S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N'-[2-[(1,3-dimethylimidazol-1-ium-2-yl)diazenyl]phenyl]ethane-1,2-diamine;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].Cn1cc[n+](C)c1/N=N/c1ccccc1NCCN |
| InChI | InChI=1S/C13H18N6.CH4O4S/c1-18-9-10-19(2)13(18)17-16-12-6-4-3-5-11(12)15-8-7-14;1-5-6(2,3)4/h3-6,9-10H,7-8,14H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | QVDIRLNLXCNBNC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|