C28H34N4O — CID 160529488
N-[4-[5-[[(3aR,6aS)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyrazin-2-yl]phenyl]acetamide (PubChem CID 160529488) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is N-[4-[5-[[(3aR,6aS)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyrazin-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[5-[[(3aR,6aS)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyrazin-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 160529488 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-[4-[5-[[(3aR,6aS)-2-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methyl]pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2cnc(CC3C[C@@H]4CN(CC5CC6C=CC5C6)C[C@@H]4C3)cn2)cc1 |
| InChI | InChI=1S/C28H34N4O/c1-18(33)31-26-6-4-21(5-7-26)28-14-29-27(13-30-28)12-20-10-24-16-32(17-25(24)11-20)15-23-9-19-2-3-22(23)8-19/h2-7,13-14,19-20,22-25H,8-12,15-17H2,1H3,(H,31,33)/t19?,20?,22?,23?,24-,25+ |
| InChIKey | QVIRJBOWWRRGNV-ZJHYMYKUSA-N |
| XLogP | 4.81 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|