About 7-amino-9H-fluoren-2-ol
7-amino-9H-fluoren-2-ol (PubChem CID 16053) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 7-amino-9H-fluoren-2-ol.
Molecular Properties
| Compound Name | 7-amino-9H-fluoren-2-ol |
| PubChem CID | 16053 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 7-amino-9H-fluoren-2-ol |
| SMILES | Nc1ccc2c(c1)Cc1cc(O)ccc1-2 |
| InChI | InChI=1S/C13H11NO/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7,15H,5,14H2 |
| InChIKey | JNIWZBUNAVIXDB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-9H-fluoren-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-9H-fluoren-2-ol?
The IUPAC name of 7-amino-9H-fluoren-2-ol (CID 16053) is 7-amino-9H-fluoren-2-ol.
What is the SMILES notation for 7-amino-9H-fluoren-2-ol?
The canonical SMILES for 7-amino-9H-fluoren-2-ol is Nc1ccc2c(c1)Cc1cc(O)ccc1-2.
What is the InChIKey of 7-amino-9H-fluoren-2-ol?
The InChIKey is JNIWZBUNAVIXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7,15H,5,14H2.
What are the key properties of 7-amino-9H-fluoren-2-ol?
7-amino-9H-fluoren-2-ol has a molecular weight of 197.24 g/mol, XLogP of 2.55, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-9H-fluoren-2-ol is sourced from PubChem (CID 16053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).