C13H6Cl4F6O3 — CID 160530349
1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 160530349) has the molecular formula C13H6Cl4F6O3 and a molecular weight of 465.99 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160530349 |
| Molecular Formula | C13H6Cl4F6O3 |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 463.90 |
| IUPAC Name | 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | Clc1cc(Cl)cc(C2CC2(Cl)Cl)c1.O=C(OC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H6Cl4.C4F6O3/c10-6-1-5(2-7(11)3-6)8-4-9(8,12)13;5-3(6,7)1(11)13-2(12)4(8,9)10/h1-3,8H,4H2; |
| InChIKey | QVLLAJBIPTXUOQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|