C32H27N3O5 — CID 160531114
6-phenylmethoxy-1H-indole-2-carboxamide;6-phenylmethoxy-1H-indole-2-carboxylic acid (PubChem CID 160531114) has the molecular formula C32H27N3O5 and a molecular weight of 533.58 g/mol. Its IUPAC name is 6-phenylmethoxy-1H-indole-2-carboxamide;6-phenylmethoxy-1H-indole-2-carboxylic acid.
| Compound Name | 6-phenylmethoxy-1H-indole-2-carboxamide;6-phenylmethoxy-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 160531114 |
| Molecular Formula | C32H27N3O5 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | 6-phenylmethoxy-1H-indole-2-carboxamide;6-phenylmethoxy-1H-indole-2-carboxylic acid |
| SMILES | NC(=O)c1cc2ccc(OCc3ccccc3)cc2[nH]1.O=C(O)c1cc2ccc(OCc3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C16H14N2O2.C16H13NO3/c17-16(19)15-8-12-6-7-13(9-14(12)18-15)20-10-11-4-2-1-3-5-11;18-16(19)15-8-12-6-7-13(9-14(12)17-15)20-10-11-4-2-1-3-5-11/h1-9,18H,10H2,(H2,17,19);1-9,17H,10H2,(H,18,19) |
| InChIKey | QVNWVRRTGZOMNO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |