C23H23FN2O3 — CID 160532003
(3S)-3-(3-fluorophenyl)-4-hydroxy-1-[3-(oxolan-3-ylamino)isoquinolin-6-yl]butan-1-one (PubChem CID 160532003) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is (3S)-3-(3-fluorophenyl)-4-hydroxy-1-[3-(oxolan-3-ylamino)isoquinolin-6-yl]butan-1-one.
| Compound Name | (3S)-3-(3-fluorophenyl)-4-hydroxy-1-[3-(oxolan-3-ylamino)isoquinolin-6-yl]butan-1-one |
|---|---|
| PubChem CID | 160532003 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (3S)-3-(3-fluorophenyl)-4-hydroxy-1-[3-(oxolan-3-ylamino)isoquinolin-6-yl]butan-1-one |
| SMILES | O=C(C[C@H](CO)c1cccc(F)c1)c1ccc2cnc(NC3CCOC3)cc2c1 |
| InChI | InChI=1S/C23H23FN2O3/c24-20-3-1-2-15(9-20)19(13-27)10-22(28)16-4-5-17-12-25-23(11-18(17)8-16)26-21-6-7-29-14-21/h1-5,8-9,11-12,19,21,27H,6-7,10,13-14H2,(H,25,26)/t19-,21?/m1/s1 |
| InChIKey | QVRATPGEJAGGPM-YMBRHYMPSA-N |
| XLogP | 3.92 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |