About phthalazine;piperazine
phthalazine;piperazine (PubChem CID 160532131) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is phthalazine;piperazine.
Molecular Properties
| Compound Name | phthalazine;piperazine |
| PubChem CID | 160532131 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | phthalazine;piperazine |
| SMILES | C1CNCCN1.c1ccc2cnncc2c1 |
| InChI | InChI=1S/C8H6N2.C4H10N2/c1-2-4-8-6-10-9-5-7(8)3-1;1-2-6-4-3-5-1/h1-6H;5-6H,1-4H2 |
| InChIKey | QVRLQQSHDHUWAV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phthalazine;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazine;piperazine?
The IUPAC name of phthalazine;piperazine (CID 160532131) is phthalazine;piperazine.
What is the SMILES notation for phthalazine;piperazine?
The canonical SMILES for phthalazine;piperazine is C1CNCCN1.c1ccc2cnncc2c1.
What is the InChIKey of phthalazine;piperazine?
The InChIKey is QVRLQQSHDHUWAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2.C4H10N2/c1-2-4-8-6-10-9-5-7(8)3-1;1-2-6-4-3-5-1/h1-6H;5-6H,1-4H2.
What are the key properties of phthalazine;piperazine?
phthalazine;piperazine has a molecular weight of 216.29 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazine;piperazine is sourced from PubChem (CID 160532131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).