C17H26FNO — CID 160532816
4-[(5-tert-butyl-2,3,4-trideuterio-6-fluorophenyl)-dideuteriomethyl]-2,3,3,5,5,6-hexadeuterio-2-methyl-6-(trideuteriomethyl)morpholine (PubChem CID 160532816) has the molecular formula C17H26FNO and a molecular weight of 293.48 g/mol. Its IUPAC name is 4-[(5-tert-butyl-2,3,4-trideuterio-6-fluorophenyl)-dideuteriomethyl]-2,3,3,5,5,6-hexadeuterio-2-methyl-6-(trideuteriomethyl)morpholine.
| Compound Name | 4-[(5-tert-butyl-2,3,4-trideuterio-6-fluorophenyl)-dideuteriomethyl]-2,3,3,5,5,6-hexadeuterio-2-methyl-6-(trideuteriomethyl)morpholine |
|---|---|
| PubChem CID | 160532816 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.29 |
| IUPAC Name | 4-[(5-tert-butyl-2,3,4-trideuterio-6-fluorophenyl)-dideuteriomethyl]-2,3,3,5,5,6-hexadeuterio-2-methyl-6-(trideuteriomethyl)morpholine |
| SMILES | [2H]c1c([2H])c(C(C)(C)C)c(F)c(C([2H])([2H])N2C([2H])([2H])C([2H])(C)OC([2H])(C([2H])([2H])[2H])C2([2H])[2H])c1[2H] |
| InChI | InChI=1S/C17H26FNO/c1-12-9-19(10-13(2)20-12)11-14-7-6-8-15(16(14)18)17(3,4)5/h6-8,12-13H,9-11H2,1-5H3/i1D3,6D,7D,8D,9D2,10D2,11D2,12D,13D |
| InChIKey | ZEQZEWGXKWJVQY-ACKYFZGLSA-N |
| XLogP | 3.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |