C25H44O2 — CID 160532911
heptane;methane;2-(6-methylnaphthalen-2-yl)ethyl acetate (PubChem CID 160532911) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is heptane;methane;2-(6-methylnaphthalen-2-yl)ethyl acetate.
| Compound Name | heptane;methane;2-(6-methylnaphthalen-2-yl)ethyl acetate |
|---|---|
| PubChem CID | 160532911 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | heptane;methane;2-(6-methylnaphthalen-2-yl)ethyl acetate |
| SMILES | C.C.C.CC(=O)OCCc1ccc2cc(C)ccc2c1.CCCCCCC |
| InChI | InChI=1S/C15H16O2.C7H16.3CH4/c1-11-3-5-15-10-13(4-6-14(15)9-11)7-8-17-12(2)16;1-3-5-7-6-4-2;;;/h3-6,9-10H,7-8H2,1-2H3;3-7H2,1-2H3;3*1H4 |
| InChIKey | QVTZNVMMAAEYRH-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|