C13H23N — CID 160535336
9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane (PubChem CID 160535336) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane.
| Compound Name | 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane |
|---|---|
| PubChem CID | 160535336 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 9a-methyl-3,4,6,9-tetrahydrocyclohepta[b]pyridine;methane |
| SMILES | C.C.CC12CC=CCC=C1CCC=N2 |
| InChI | InChI=1S/C11H15N.2CH4/c1-11-8-4-2-3-6-10(11)7-5-9-12-11;;/h2,4,6,9H,3,5,7-8H2,1H3;2*1H4 |
| InChIKey | QWBRRUUGVQHKEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|