C23H25BrCl2O3 — CID 160538863
1-(5-bromo-2-chlorophenyl)cyclopentan-1-ol;4-chloro-3-(1-hydroxycyclopentyl)benzaldehyde (PubChem CID 160538863) has the molecular formula C23H25BrCl2O3 and a molecular weight of 500.26 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)cyclopentan-1-ol;4-chloro-3-(1-hydroxycyclopentyl)benzaldehyde.
| Compound Name | 1-(5-bromo-2-chlorophenyl)cyclopentan-1-ol;4-chloro-3-(1-hydroxycyclopentyl)benzaldehyde |
|---|---|
| PubChem CID | 160538863 |
| Molecular Formula | C23H25BrCl2O3 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)cyclopentan-1-ol;4-chloro-3-(1-hydroxycyclopentyl)benzaldehyde |
| SMILES | O=Cc1ccc(Cl)c(C2(O)CCCC2)c1.OC1(c2cc(Br)ccc2Cl)CCCC1 |
| InChI | InChI=1S/C12H13ClO2.C11H12BrClO/c13-11-4-3-9(8-14)7-10(11)12(15)5-1-2-6-12;12-8-3-4-10(13)9(7-8)11(14)5-1-2-6-11/h3-4,7-8,15H,1-2,5-6H2;3-4,7,14H,1-2,5-6H2 |
| InChIKey | QWMXVDNQAOBZNX-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|