About 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid
5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid (PubChem CID 160540355) has the molecular formula C21H24BBrF3NO3
and a molecular weight of 486.14 g/mol. Its IUPAC name is 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid.
Molecular Properties
| Compound Name | 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid |
| PubChem CID | 160540355 |
| Molecular Formula | C21H24BBrF3NO3 |
| Molecular Weight | 486.14 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid |
| SMILES | CCC(CC)Cn1ccc2cc(Br)ccc21.OB(O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18BrN.C7H6BF3O3/c1-3-11(4-2)10-16-8-7-12-9-13(15)5-6-14(12)16;9-7(10,11)14-6-3-1-5(2-4-6)8(12)13/h5-9,11H,3-4,10H2,1-2H3;1-4,12-13H |
| InChIKey | QWRXJPVXCZIOGG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.14 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid?
The IUPAC name of 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid (CID 160540355) is 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid.
What is the SMILES notation for 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid?
The canonical SMILES for 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid is CCC(CC)Cn1ccc2cc(Br)ccc21.OB(O)c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid?
The InChIKey is QWRXJPVXCZIOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN.C7H6BF3O3/c1-3-11(4-2)10-16-8-7-12-9-13(15)5-6-14(12)16;9-7(10,11)14-6-3-1-5(2-4-6)8(12)13/h5-9,11H,3-4,10H2,1-2H3;1-4,12-13H.
What are the key properties of 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid?
5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid has a molecular weight of 486.14 g/mol, XLogP of 5.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2-ethylbutyl)indole;[4-(trifluoromethoxy)phenyl]boronic acid is sourced from PubChem (CID 160540355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).